C15H22O2S2 — CID 11565648
O-ethyl [2-[(2S,5R)-2,5-bis(ethenyl)-1-methylcyclopentyl]-2-oxoethyl]sulfanylmethanethioate (PubChem CID 11565648) has the molecular formula C15H22O2S2 and a molecular weight of 298.47 g/mol. Its IUPAC name is O-ethyl [2-[(2S,5R)-2,5-bis(ethenyl)-1-methylcyclopentyl]-2-oxoethyl]sulfanylmethanethioate.
| Compound Name | O-ethyl [2-[(2S,5R)-2,5-bis(ethenyl)-1-methylcyclopentyl]-2-oxoethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 11565648 |
| Molecular Formula | C15H22O2S2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | O-ethyl [2-[(2S,5R)-2,5-bis(ethenyl)-1-methylcyclopentyl]-2-oxoethyl]sulfanylmethanethioate |
| SMILES | C=C[C@@H]1CC[C@H](C=C)C1(C)C(=O)CSC(=S)OCC |
| InChI | InChI=1S/C15H22O2S2/c1-5-11-8-9-12(6-2)15(11,4)13(16)10-19-14(18)17-7-3/h5-6,11-12H,1-2,7-10H2,3-4H3/t11-,12+,15? |
| InChIKey | NMDBFVYNRQMJCA-ODOQXGPZSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|