C10H16F3N3O — CID 115656833
3,3,3-trifluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine (PubChem CID 115656833) has the molecular formula C10H16F3N3O and a molecular weight of 251.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115656833 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3,3,3-trifluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine |
| SMILES | COc1c(CNCCC(F)(F)F)c(C)nn1C |
| InChI | InChI=1S/C10H16F3N3O/c1-7-8(9(17-3)16(2)15-7)6-14-5-4-10(11,12)13/h14H,4-6H2,1-3H3 |
| InChIKey | NILPNNXTGQNRAW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|