About 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol
3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol (PubChem CID 115658654) has the molecular formula C11H15N3OS
and a molecular weight of 237.33 g/mol. Its IUPAC name is 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol |
| PubChem CID | 115658654 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol |
| SMILES | CCN(CCCO)c1ncnc2ccsc12 |
| InChI | InChI=1S/C11H15N3OS/c1-2-14(5-3-6-15)11-10-9(4-7-16-10)12-8-13-11/h4,7-8,15H,2-3,5-6H2,1H3 |
| InChIKey | MBADTJGARXCHLX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol?
The IUPAC name of 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol (CID 115658654) is 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol?
The canonical SMILES for 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol is CCN(CCCO)c1ncnc2ccsc12.
What is the InChIKey of 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol?
The InChIKey is MBADTJGARXCHLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3OS/c1-2-14(5-3-6-15)11-10-9(4-7-16-10)12-8-13-11/h4,7-8,15H,2-3,5-6H2,1H3.
What are the key properties of 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol?
3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol has a molecular weight of 237.33 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(thieno[3,2-d]pyrimidin-4-yl)amino]propan-1-ol is sourced from PubChem (CID 115658654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).