C16H17N3S — CID 115658711
2-(2-ethylthiomorpholin-4-yl)quinoline-4-carbonitrile (PubChem CID 115658711) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-(2-ethylthiomorpholin-4-yl)quinoline-4-carbonitrile.
| Compound Name | 2-(2-ethylthiomorpholin-4-yl)quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 115658711 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(2-ethylthiomorpholin-4-yl)quinoline-4-carbonitrile |
| SMILES | CCC1CN(c2cc(C#N)c3ccccc3n2)CCS1 |
| InChI | InChI=1S/C16H17N3S/c1-2-13-11-19(7-8-20-13)16-9-12(10-17)14-5-3-4-6-15(14)18-16/h3-6,9,13H,2,7-8,11H2,1H3 |
| InChIKey | DBJSMQRUDIQNNV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |