C10H14N4O2 — CID 115658924
4,6-dimethoxy-N-pent-4-yn-2-yl-1,3,5-triazin-2-amine (PubChem CID 115658924) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 4,6-dimethoxy-N-pent-4-yn-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimethoxy-N-pent-4-yn-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115658924 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 4,6-dimethoxy-N-pent-4-yn-2-yl-1,3,5-triazin-2-amine |
| SMILES | C#CCC(C)Nc1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C10H14N4O2/c1-5-6-7(2)11-8-12-9(15-3)14-10(13-8)16-4/h1,7H,6H2,2-4H3,(H,11,12,13,14) |
| InChIKey | DKBPLQVMENXYMV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|