C10H10N2O2S — CID 115659308
3-[(6-methoxy-2-pyridinyl)methyl]-1,3-thiazol-2-one (PubChem CID 115659308) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-[(6-methoxy-2-pyridinyl)methyl]-1,3-thiazol-2-one.
| Compound Name | 3-[(6-methoxy-2-pyridinyl)methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115659308 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3-[(6-methoxy-2-pyridinyl)methyl]-1,3-thiazol-2-one |
| SMILES | COc1cccc(Cn2ccsc2=O)n1 |
| InChI | InChI=1S/C10H10N2O2S/c1-14-9-4-2-3-8(11-9)7-12-5-6-15-10(12)13/h2-6H,7H2,1H3 |
| InChIKey | RAICHKWROJPMKI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |