C15H15FN2S — CID 115660169
N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]pent-4-yn-2-amine (PubChem CID 115660169) has the molecular formula C15H15FN2S and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]pent-4-yn-2-amine.
| Compound Name | N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]pent-4-yn-2-amine |
|---|---|
| PubChem CID | 115660169 |
| Molecular Formula | C15H15FN2S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]pent-4-yn-2-amine |
| SMILES | C#CCC(C)NCc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H15FN2S/c1-3-4-11(2)17-9-14-10-19-15(18-14)12-5-7-13(16)8-6-12/h1,5-8,10-11,17H,4,9H2,2H3 |
| InChIKey | SMHLQIMQHGZDCO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|