C10H17NO7P2 — CID 11566043
[2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-1-phosphonoethyl]phosphonic acid (PubChem CID 11566043) has the molecular formula C10H17NO7P2 and a molecular weight of 325.19 g/mol. Its IUPAC name is [2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 11566043 |
| Molecular Formula | C10H17NO7P2 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-1-phosphonoethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CN[C@@H](CO)c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C10H17NO7P2/c12-7-9(8-4-2-1-3-5-8)11-6-10(19(13,14)15)20(16,17)18/h1-5,9-12H,6-7H2,(H2,13,14,15)(H2,16,17,18)/t9-/m0/s1 |
| InChIKey | VHVIAONLCAKZOT-VIFPVBQESA-N |
| XLogP | -0.01 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|