C13H19BrN2O2S — CID 115660499
N-[(4-bromo-3-nitrophenyl)methyl]-4-ethylsulfanylbutan-2-amine (PubChem CID 115660499) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-[(4-bromo-3-nitrophenyl)methyl]-4-ethylsulfanylbutan-2-amine.
| Compound Name | N-[(4-bromo-3-nitrophenyl)methyl]-4-ethylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 115660499 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-[(4-bromo-3-nitrophenyl)methyl]-4-ethylsulfanylbutan-2-amine |
| SMILES | CCSCCC(C)NCc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19BrN2O2S/c1-3-19-7-6-10(2)15-9-11-4-5-12(14)13(8-11)16(17)18/h4-5,8,10,15H,3,6-7,9H2,1-2H3 |
| InChIKey | LYARFZHGCRRIBV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|