C12H14N2O — CID 115661055
1-pent-4-yn-2-yl-3-phenylurea (PubChem CID 115661055) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-pent-4-yn-2-yl-3-phenylurea.
| Compound Name | 1-pent-4-yn-2-yl-3-phenylurea |
|---|---|
| PubChem CID | 115661055 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-pent-4-yn-2-yl-3-phenylurea |
| SMILES | C#CCC(C)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H14N2O/c1-3-7-10(2)13-12(15)14-11-8-5-4-6-9-11/h1,4-6,8-10H,7H2,2H3,(H2,13,14,15) |
| InChIKey | WZFMFFWWZUBUIN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|