About (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one
(3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one (PubChem CID 11566107) has the molecular formula C18H32O5
and a molecular weight of 328.45 g/mol. Its IUPAC name is (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one.
Molecular Properties
| Compound Name | (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one |
| PubChem CID | 11566107 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one |
| SMILES | CCCCCC1CCCCCC(O)CC(O)C(O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C18H32O5/c1-2-3-5-9-15-10-7-4-6-8-14(19)13-17(21)16(20)11-12-18(22)23-15/h11-12,14-17,19-21H,2-10,13H2,1H3/b12-11+ |
| InChIKey | LEEBEEPDVOWSDN-VAWYXSNFSA-N |
| XLogP | 2.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one?
The IUPAC name of (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one (CID 11566107) is (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one.
What is the SMILES notation for (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one?
The canonical SMILES for (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one is CCCCCC1CCCCCC(O)CC(O)C(O)/C=C/C(=O)O1.
What is the InChIKey of (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one?
The InChIKey is LEEBEEPDVOWSDN-VAWYXSNFSA-N. The full InChI is InChI=1S/C18H32O5/c1-2-3-5-9-15-10-7-4-6-8-14(19)13-17(21)16(20)11-12-18(22)23-15/h11-12,14-17,19-21H,2-10,13H2,1H3/b12-11+.
What are the key properties of (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one?
(3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one has a molecular weight of 328.45 g/mol, XLogP of 2.47, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5,6,8-trihydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one is sourced from PubChem (CID 11566107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).