About N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide
N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide (PubChem CID 115661266) has the molecular formula C8H13N3O2S
and a molecular weight of 215.28 g/mol. Its IUPAC name is N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide |
| PubChem CID | 115661266 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide |
| SMILES | Cc1nsc(NC(=O)COC(C)C)n1 |
| InChI | InChI=1S/C8H13N3O2S/c1-5(2)13-4-7(12)10-8-9-6(3)11-14-8/h5H,4H2,1-3H3,(H,9,10,11,12) |
| InChIKey | WBGOBHPNIKORNV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide?
The IUPAC name of N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide (CID 115661266) is N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide.
What is the SMILES notation for N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide?
The canonical SMILES for N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide is Cc1nsc(NC(=O)COC(C)C)n1.
What is the InChIKey of N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide?
The InChIKey is WBGOBHPNIKORNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S/c1-5(2)13-4-7(12)10-8-9-6(3)11-14-8/h5H,4H2,1-3H3,(H,9,10,11,12).
What are the key properties of N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide?
N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide has a molecular weight of 215.28 g/mol, XLogP of 1.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,2,4-thiadiazol-5-yl)-2-propan-2-yloxyacetamide is sourced from PubChem (CID 115661266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).