C15H26O6Si — CID 11566131
2-[(1R,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(carboxymethyl)-3-oxocyclopentyl]acetic acid (PubChem CID 11566131) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-[(1R,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(carboxymethyl)-3-oxocyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(carboxymethyl)-3-oxocyclopentyl]acetic acid |
|---|---|
| PubChem CID | 11566131 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[(1R,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(carboxymethyl)-3-oxocyclopentyl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)[C@@H](CC(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C15H26O6Si/c1-15(2,3)22(4,5)21-12-8-11(16)9(6-13(17)18)10(12)7-14(19)20/h9-10,12H,6-8H2,1-5H3,(H,17,18)(H,19,20)/t9-,10+,12-/m0/s1 |
| InChIKey | XOYYAWBSLOMGLV-UMNHJUIQSA-N |
| XLogP | 2.53 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|