C15H13BrFNO3 — CID 115661440
N-(3-bromo-4-fluorophenyl)-2,5-dimethoxybenzamide (PubChem CID 115661440) has the molecular formula C15H13BrFNO3 and a molecular weight of 354.18 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-2,5-dimethoxybenzamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 115661440 |
| Molecular Formula | C15H13BrFNO3 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2ccc(F)c(Br)c2)c1 |
| InChI | InChI=1S/C15H13BrFNO3/c1-20-10-4-6-14(21-2)11(8-10)15(19)18-9-3-5-13(17)12(16)7-9/h3-8H,1-2H3,(H,18,19) |
| InChIKey | NDGSNDAFIMVAFV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |