About methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate
methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate (PubChem CID 11566205) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate |
| PubChem CID | 11566205 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1CCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-25-22(24)21-15-9-17-23(21)16-8-14-20(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-7,10-14,21H,8-9,15-17H2,1H3/t21-/m1/s1 |
| InChIKey | ACDYCJICFXSYRA-OAQYLSRUSA-N |
| XLogP | 4.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate?
The IUPAC name of methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate (CID 11566205) is methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate?
The canonical SMILES for methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate is COC(=O)[C@H]1CCCN1CCC=C(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate?
The InChIKey is ACDYCJICFXSYRA-OAQYLSRUSA-N. The full InChI is InChI=1S/C22H25NO2/c1-25-22(24)21-15-9-17-23(21)16-8-14-20(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-7,10-14,21H,8-9,15-17H2,1H3/t21-/m1/s1.
What are the key properties of methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate?
methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate has a molecular weight of 335.45 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 11566205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).