C18H27NO5 — CID 11566242
methyl (4aR,5S,6E,8aS)-5-(acetyloxymethyl)-6-hydroxyimino-2,5,8a-trimethyl-4,4a,7,8-tetrahydro-3H-naphthalene-1-carboxylate (PubChem CID 11566242) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl (4aR,5S,6E,8aS)-5-(acetyloxymethyl)-6-hydroxyimino-2,5,8a-trimethyl-4,4a,7,8-tetrahydro-3H-naphthalene-1-carboxylate.
| Compound Name | methyl (4aR,5S,6E,8aS)-5-(acetyloxymethyl)-6-hydroxyimino-2,5,8a-trimethyl-4,4a,7,8-tetrahydro-3H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11566242 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | methyl (4aR,5S,6E,8aS)-5-(acetyloxymethyl)-6-hydroxyimino-2,5,8a-trimethyl-4,4a,7,8-tetrahydro-3H-naphthalene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)CC[C@@H]2[C@]1(C)CC/C(=N\O)[C@@]2(C)COC(C)=O |
| InChI | InChI=1S/C18H27NO5/c1-11-6-7-13-17(3,15(11)16(21)23-5)9-8-14(19-22)18(13,4)10-24-12(2)20/h13,22H,6-10H2,1-5H3/b19-14+/t13-,17+,18+/m1/s1 |
| InChIKey | XLZUKXGBZBRYIY-XIFWGAJUSA-N |
| XLogP | 3.09 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|