About 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide
2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide (PubChem CID 11566274) has the molecular formula C16H9N3O6
and a molecular weight of 339.26 g/mol. Its IUPAC name is 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide.
Molecular Properties
| Compound Name | 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide |
| PubChem CID | 11566274 |
| Molecular Formula | C16H9N3O6 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide |
| SMILES | O=C1NC(=O)c2ccc(NC(=O)c3ccccc3[N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C16H9N3O6/c20-13-11-7-8(5-6-9(11)14(21)18-16(13)23)17-15(22)10-3-1-2-4-12(10)19(24)25/h1-7H,(H,17,22)(H,18,21,23) |
| InChIKey | RFENAPIXTTTXOV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide?
The IUPAC name of 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide (CID 11566274) is 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide.
What is the SMILES notation for 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide?
The canonical SMILES for 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide is O=C1NC(=O)c2ccc(NC(=O)c3ccccc3[N+](=O)[O-])cc2C1=O.
What is the InChIKey of 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide?
The InChIKey is RFENAPIXTTTXOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N3O6/c20-13-11-7-8(5-6-9(11)14(21)18-16(13)23)17-15(22)10-3-1-2-4-12(10)19(24)25/h1-7H,(H,17,22)(H,18,21,23).
What are the key properties of 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide?
2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide has a molecular weight of 339.26 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide is sourced from PubChem (CID 11566274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).