About 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea
1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea (PubChem CID 115664764) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea |
| PubChem CID | 115664764 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NCCC(F)(F)F)NC1CCCC1 |
| InChI | InChI=1S/C9H15F3N2O/c10-9(11,12)5-6-13-8(15)14-7-3-1-2-4-7/h7H,1-6H2,(H2,13,14,15) |
| InChIKey | CHZCYZAZTQZCBB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea?
The IUPAC name of 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea (CID 115664764) is 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea.
What is the SMILES notation for 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea?
The canonical SMILES for 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea is O=C(NCCC(F)(F)F)NC1CCCC1.
What is the InChIKey of 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea?
The InChIKey is CHZCYZAZTQZCBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O/c10-9(11,12)5-6-13-8(15)14-7-3-1-2-4-7/h7H,1-6H2,(H2,13,14,15).
What are the key properties of 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea?
1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea has a molecular weight of 224.23 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-(3,3,3-trifluoropropyl)urea is sourced from PubChem (CID 115664764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).