C11H19N3 — CID 11566567
N-[[6-(ethylaminomethyl)-2-pyridinyl]methyl]ethanamine (PubChem CID 11566567) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-[[6-(ethylaminomethyl)-2-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[6-(ethylaminomethyl)-2-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 11566567 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-[[6-(ethylaminomethyl)-2-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(CNCC)n1 |
| InChI | InChI=1S/C11H19N3/c1-3-12-8-10-6-5-7-11(14-10)9-13-4-2/h5-7,12-13H,3-4,8-9H2,1-2H3 |
| InChIKey | GEVDHNPPEBBUGR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |