C16H21N3OS — CID 115666843
N-(3-cyanophenyl)-3-(2,3-dimethylthiomorpholin-4-yl)propanamide (PubChem CID 115666843) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is N-(3-cyanophenyl)-3-(2,3-dimethylthiomorpholin-4-yl)propanamide.
| Compound Name | N-(3-cyanophenyl)-3-(2,3-dimethylthiomorpholin-4-yl)propanamide |
|---|---|
| PubChem CID | 115666843 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-(3-cyanophenyl)-3-(2,3-dimethylthiomorpholin-4-yl)propanamide |
| SMILES | CC1SCCN(CCC(=O)Nc2cccc(C#N)c2)C1C |
| InChI | InChI=1S/C16H21N3OS/c1-12-13(2)21-9-8-19(12)7-6-16(20)18-15-5-3-4-14(10-15)11-17/h3-5,10,12-13H,6-9H2,1-2H3,(H,18,20) |
| InChIKey | IXBIYQWFGCXXDW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |