About 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol
4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol (PubChem CID 115666950) has the molecular formula C9H18N4O
and a molecular weight of 198.27 g/mol. Its IUPAC name is 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol.
Molecular Properties
| Compound Name | 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol |
| PubChem CID | 115666950 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol |
| SMILES | CC(O)CCN(C)Cc1nncn1C |
| InChI | InChI=1S/C9H18N4O/c1-8(14)4-5-12(2)6-9-11-10-7-13(9)3/h7-8,14H,4-6H2,1-3H3 |
| InChIKey | UGHYTQZPMGLFFO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol?
The IUPAC name of 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol (CID 115666950) is 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol.
What is the SMILES notation for 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol?
The canonical SMILES for 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol is CC(O)CCN(C)Cc1nncn1C.
What is the InChIKey of 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol?
The InChIKey is UGHYTQZPMGLFFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O/c1-8(14)4-5-12(2)6-9-11-10-7-13(9)3/h7-8,14H,4-6H2,1-3H3.
What are the key properties of 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol?
4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol has a molecular weight of 198.27 g/mol, XLogP of 0.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl-[(4-methyl-1,2,4-triazol-3-yl)methyl]amino]butan-2-ol is sourced from PubChem (CID 115666950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).