About 1-cyclopentyl-3-(2,2-difluoroethyl)urea
1-cyclopentyl-3-(2,2-difluoroethyl)urea (PubChem CID 115667099) has the molecular formula C8H14F2N2O
and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,2-difluoroethyl)urea.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-(2,2-difluoroethyl)urea |
| PubChem CID | 115667099 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1-cyclopentyl-3-(2,2-difluoroethyl)urea |
| SMILES | O=C(NCC(F)F)NC1CCCC1 |
| InChI | InChI=1S/C8H14F2N2O/c9-7(10)5-11-8(13)12-6-3-1-2-4-6/h6-7H,1-5H2,(H2,11,12,13) |
| InChIKey | QSFFUHCLYWLJTH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopentyl-3-(2,2-difluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-(2,2-difluoroethyl)urea?
The IUPAC name of 1-cyclopentyl-3-(2,2-difluoroethyl)urea (CID 115667099) is 1-cyclopentyl-3-(2,2-difluoroethyl)urea.
What is the SMILES notation for 1-cyclopentyl-3-(2,2-difluoroethyl)urea?
The canonical SMILES for 1-cyclopentyl-3-(2,2-difluoroethyl)urea is O=C(NCC(F)F)NC1CCCC1.
What is the InChIKey of 1-cyclopentyl-3-(2,2-difluoroethyl)urea?
The InChIKey is QSFFUHCLYWLJTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O/c9-7(10)5-11-8(13)12-6-3-1-2-4-6/h6-7H,1-5H2,(H2,11,12,13).
What are the key properties of 1-cyclopentyl-3-(2,2-difluoroethyl)urea?
1-cyclopentyl-3-(2,2-difluoroethyl)urea has a molecular weight of 192.21 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-(2,2-difluoroethyl)urea is sourced from PubChem (CID 115667099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).