About ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate
ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate (PubChem CID 11566725) has the molecular formula C15H16F3NO4S
and a molecular weight of 363.36 g/mol. Its IUPAC name is ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| PubChem CID | 11566725 |
| Molecular Formula | C15H16F3NO4S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H16F3NO4S/c1-2-23-15(20)9-5-3-4-6-14(9)24(21,22)19-13-8-11(17)10(16)7-12(13)18/h5,7-8,14,19H,2-4,6H2,1H3 |
| InChIKey | TWYGKUPLZKSOHO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The IUPAC name of ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate (CID 11566725) is ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate.
What is the SMILES notation for ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The canonical SMILES for ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate is CCOC(=O)C1=CCCCC1S(=O)(=O)Nc1cc(F)c(F)cc1F.
What is the InChIKey of ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The InChIKey is TWYGKUPLZKSOHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3NO4S/c1-2-23-15(20)9-5-3-4-6-14(9)24(21,22)19-13-8-11(17)10(16)7-12(13)18/h5,7-8,14,19H,2-4,6H2,1H3.
What are the key properties of ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate has a molecular weight of 363.36 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[(2,4,5-trifluorophenyl)sulfamoyl]cyclohexene-1-carboxylate is sourced from PubChem (CID 11566725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).