C14H18N2O2S — CID 115667514
3-(3-propylpyrrolidin-1-yl)sulfonylbenzonitrile (PubChem CID 115667514) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-(3-propylpyrrolidin-1-yl)sulfonylbenzonitrile.
| Compound Name | 3-(3-propylpyrrolidin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 115667514 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(3-propylpyrrolidin-1-yl)sulfonylbenzonitrile |
| SMILES | CCCC1CCN(S(=O)(=O)c2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C14H18N2O2S/c1-2-4-12-7-8-16(11-12)19(17,18)14-6-3-5-13(9-14)10-15/h3,5-6,9,12H,2,4,7-8,11H2,1H3 |
| InChIKey | RYQGXOVNXJZDHL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |