C12H11F3N4O2 — CID 115668356
N-[2-(1H-imidazol-2-yl)ethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 115668356) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is N-[2-(1H-imidazol-2-yl)ethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-(1H-imidazol-2-yl)ethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115668356 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[2-(1H-imidazol-2-yl)ethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ncc[nH]1)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C12H11F3N4O2/c13-12(14,15)8-2-1-7(11(21)19-8)10(20)18-4-3-9-16-5-6-17-9/h1-2,5-6H,3-4H2,(H,16,17)(H,18,20)(H,19,21) |
| InChIKey | LWWCPXHFKNPTFF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |