C14H15N3O3 — CID 115669126
1-[[(6-nitroquinolin-2-yl)amino]methyl]cyclobutan-1-ol (PubChem CID 115669126) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 1-[[(6-nitroquinolin-2-yl)amino]methyl]cyclobutan-1-ol.
| Compound Name | 1-[[(6-nitroquinolin-2-yl)amino]methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 115669126 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-[[(6-nitroquinolin-2-yl)amino]methyl]cyclobutan-1-ol |
| SMILES | O=[N+]([O-])c1ccc2nc(NCC3(O)CCC3)ccc2c1 |
| InChI | InChI=1S/C14H15N3O3/c18-14(6-1-7-14)9-15-13-5-2-10-8-11(17(19)20)3-4-12(10)16-13/h2-5,8,18H,1,6-7,9H2,(H,15,16) |
| InChIKey | JQARLIYLIIHCEB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|