About oxetan-3-yl 3-amino-4-fluorobenzoate
oxetan-3-yl 3-amino-4-fluorobenzoate (PubChem CID 115669798) has the molecular formula C10H10FNO3
and a molecular weight of 211.19 g/mol. Its IUPAC name is oxetan-3-yl 3-amino-4-fluorobenzoate.
Molecular Properties
| Compound Name | oxetan-3-yl 3-amino-4-fluorobenzoate |
| PubChem CID | 115669798 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | oxetan-3-yl 3-amino-4-fluorobenzoate |
| SMILES | Nc1cc(C(=O)OC2COC2)ccc1F |
| InChI | InChI=1S/C10H10FNO3/c11-8-2-1-6(3-9(8)12)10(13)15-7-4-14-5-7/h1-3,7H,4-5,12H2 |
| InChIKey | NXALSNCWJPJKKZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxetan-3-yl 3-amino-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-3-yl 3-amino-4-fluorobenzoate?
The IUPAC name of oxetan-3-yl 3-amino-4-fluorobenzoate (CID 115669798) is oxetan-3-yl 3-amino-4-fluorobenzoate.
What is the SMILES notation for oxetan-3-yl 3-amino-4-fluorobenzoate?
The canonical SMILES for oxetan-3-yl 3-amino-4-fluorobenzoate is Nc1cc(C(=O)OC2COC2)ccc1F.
What is the InChIKey of oxetan-3-yl 3-amino-4-fluorobenzoate?
The InChIKey is NXALSNCWJPJKKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO3/c11-8-2-1-6(3-9(8)12)10(13)15-7-4-14-5-7/h1-3,7H,4-5,12H2.
What are the key properties of oxetan-3-yl 3-amino-4-fluorobenzoate?
oxetan-3-yl 3-amino-4-fluorobenzoate has a molecular weight of 211.19 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-3-yl 3-amino-4-fluorobenzoate is sourced from PubChem (CID 115669798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).