About 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide
4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 11567017) has the molecular formula C16H19N5O4S
and a molecular weight of 377.43 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide |
| PubChem CID | 11567017 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C16H19N5O4S/c1-9(2)19-26(24,25)11-7-5-10(6-8-11)13-17-12-14(18-13)20(3)16(23)21(4)15(12)22/h5-9,19H,1-4H3,(H,17,18) |
| InChIKey | KVBOFSFJZOSUGM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide?
The IUPAC name of 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide (CID 11567017) is 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide.
What is the SMILES notation for 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide?
The canonical SMILES for 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide is CC(C)NS(=O)(=O)c1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1.
What is the InChIKey of 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide?
The InChIKey is KVBOFSFJZOSUGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O4S/c1-9(2)19-26(24,25)11-7-5-10(6-8-11)13-17-12-14(18-13)20(3)16(23)21(4)15(12)22/h5-9,19H,1-4H3,(H,17,18).
What are the key properties of 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide?
4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide has a molecular weight of 377.43 g/mol, XLogP of 0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N-propan-2-ylbenzenesulfonamide is sourced from PubChem (CID 11567017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).