C12H21NO4 — CID 115670189
methyl 4-(2,3-dimethylbutanoyl)morpholine-3-carboxylate (PubChem CID 115670189) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is methyl 4-(2,3-dimethylbutanoyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(2,3-dimethylbutanoyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 115670189 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | methyl 4-(2,3-dimethylbutanoyl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)C(C)C(C)C |
| InChI | InChI=1S/C12H21NO4/c1-8(2)9(3)11(14)13-5-6-17-7-10(13)12(15)16-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | MROKSMZXADSLIU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |