C16H24N2O — CID 115670388
5-[(1-hydroxy-2-phenylpropan-2-yl)amino]-2,2-dimethylpentanenitrile (PubChem CID 115670388) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-[(1-hydroxy-2-phenylpropan-2-yl)amino]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[(1-hydroxy-2-phenylpropan-2-yl)amino]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 115670388 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-[(1-hydroxy-2-phenylpropan-2-yl)amino]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCNC(C)(CO)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O/c1-15(2,12-17)10-7-11-18-16(3,13-19)14-8-5-4-6-9-14/h4-6,8-9,18-19H,7,10-11,13H2,1-3H3 |
| InChIKey | OHSDEPSQINRNFY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|