About benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid
benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid (PubChem CID 11567066) has the molecular formula C19H25NO5S
and a molecular weight of 379.48 g/mol. Its IUPAC name is benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid |
| PubChem CID | 11567066 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid |
| SMILES | CC(C)[C@H](N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H17NO2.C7H8O3S/c1-9(2)11(13)12(14)15-8-10-6-4-3-5-7-10;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,9,11H,8,13H2,1-2H3;2-5H,1H3,(H,8,9,10)/t11-;/m0./s1 |
| InChIKey | QWUQVUDPBXFOKF-MERQFXBCSA-N |
| XLogP | 2.95 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid?
The IUPAC name of benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid (CID 11567066) is benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid.
What is the SMILES notation for benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid?
The canonical SMILES for benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid is CC(C)[C@H](N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid?
The InChIKey is QWUQVUDPBXFOKF-MERQFXBCSA-N. The full InChI is InChI=1S/C12H17NO2.C7H8O3S/c1-9(2)11(13)12(14)15-8-10-6-4-3-5-7-10;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,9,11H,8,13H2,1-2H3;2-5H,1H3,(H,8,9,10)/t11-;/m0./s1.
What are the key properties of benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid?
benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid has a molecular weight of 379.48 g/mol, XLogP of 2.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid is sourced from PubChem (CID 11567066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).