C21H38O4Si — CID 11567142
[(1S,3S,3aS,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-6-oxo-2,3,4,5,7,7a-hexahydro-1H-inden-1-yl] 2,2-dimethylpropanoate (PubChem CID 11567142) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is [(1S,3S,3aS,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-6-oxo-2,3,4,5,7,7a-hexahydro-1H-inden-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,3S,3aS,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-6-oxo-2,3,4,5,7,7a-hexahydro-1H-inden-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11567142 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [(1S,3S,3aS,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-6-oxo-2,3,4,5,7,7a-hexahydro-1H-inden-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)CCC(=O)C[C@H]12 |
| InChI | InChI=1S/C21H38O4Si/c1-19(2,3)18(23)24-16-13-17(25-26(8,9)20(4,5)6)21(7)11-10-14(22)12-15(16)21/h15-17H,10-13H2,1-9H3/t15-,16+,17+,21+/m1/s1 |
| InChIKey | PAJGQVYLGVWREV-JJDSTIRJSA-N |
| XLogP | 5.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|