About 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one
2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 11567383) has the molecular formula C19H15FN6OS
and a molecular weight of 394.44 g/mol. Its IUPAC name is 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one |
| PubChem CID | 11567383 |
| Molecular Formula | C19H15FN6OS |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CSc1ccc(-n2c(-c3ccc(F)cc3)nc3nc(N)nc(N)c3c2=O)cc1 |
| InChI | InChI=1S/C19H15FN6OS/c1-28-13-8-6-12(7-9-13)26-17(10-2-4-11(20)5-3-10)24-16-14(18(26)27)15(21)23-19(22)25-16/h2-9H,1H3,(H4,21,22,23,25) |
| InChIKey | VCUQRGHDDYPSTG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one?
The IUPAC name of 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one (CID 11567383) is 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one.
What is the SMILES notation for 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one?
The canonical SMILES for 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one is CSc1ccc(-n2c(-c3ccc(F)cc3)nc3nc(N)nc(N)c3c2=O)cc1.
What is the InChIKey of 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one?
The InChIKey is VCUQRGHDDYPSTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN6OS/c1-28-13-8-6-12(7-9-13)26-17(10-2-4-11(20)5-3-10)24-16-14(18(26)27)15(21)23-19(22)25-16/h2-9H,1H3,(H4,21,22,23,25).
What are the key properties of 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one?
2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one has a molecular weight of 394.44 g/mol, XLogP of 2.87, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-7-(4-fluorophenyl)-6-(4-methylsulfanylphenyl)pyrimido[4,5-d]pyrimidin-5-one is sourced from PubChem (CID 11567383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).