C12H17ClN2OS — CID 115673980
5-[[[1-(2-hydroxyethyl)cyclobutyl]amino]methyl]thiophene-3-carbonitrile;hydrochloride (PubChem CID 115673980) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is 5-[[[1-(2-hydroxyethyl)cyclobutyl]amino]methyl]thiophene-3-carbonitrile;hydrochloride.
| Compound Name | 5-[[[1-(2-hydroxyethyl)cyclobutyl]amino]methyl]thiophene-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 115673980 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-[[[1-(2-hydroxyethyl)cyclobutyl]amino]methyl]thiophene-3-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1csc(CNC2(CCO)CCC2)c1 |
| InChI | InChI=1S/C12H16N2OS.ClH/c13-7-10-6-11(16-9-10)8-14-12(4-5-15)2-1-3-12;/h6,9,14-15H,1-5,8H2;1H |
| InChIKey | UOJDGJOIUGJNES-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |