C13H26N2O — CID 115674330
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N',N',2,2-tetramethylpropane-1,3-diamine (PubChem CID 115674330) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N',N',2,2-tetramethylpropane-1,3-diamine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N',N',2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115674330 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N',N',2,2-tetramethylpropane-1,3-diamine |
| SMILES | CN(C)CC(C)(C)CNCC1=CCCOC1 |
| InChI | InChI=1S/C13H26N2O/c1-13(2,11-15(3)4)10-14-8-12-6-5-7-16-9-12/h6,14H,5,7-11H2,1-4H3 |
| InChIKey | VKFAAGVHVAQCIA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|