About 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol
2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol (PubChem CID 115674340) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol.
Molecular Properties
| Compound Name | 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol |
| PubChem CID | 115674340 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol |
| SMILES | CCC(CO)NCC1=CCCOC1 |
| InChI | InChI=1S/C10H19NO2/c1-2-10(7-12)11-6-9-4-3-5-13-8-9/h4,10-12H,2-3,5-8H2,1H3 |
| InChIKey | NERMSVXJDAISQC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol?
The IUPAC name of 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol (CID 115674340) is 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol.
What is the SMILES notation for 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol?
The canonical SMILES for 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol is CCC(CO)NCC1=CCCOC1.
What is the InChIKey of 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol?
The InChIKey is NERMSVXJDAISQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-2-10(7-12)11-6-9-4-3-5-13-8-9/h4,10-12H,2-3,5-8H2,1H3.
What are the key properties of 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol?
2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol has a molecular weight of 185.27 g/mol, XLogP of 0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol is sourced from PubChem (CID 115674340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).