About N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine
N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine (PubChem CID 115674406) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine |
| PubChem CID | 115674406 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCNCC1=CCCOC1)C1CC1 |
| InChI | InChI=1S/C13H24N2O/c1-2-15(13-5-6-13)8-7-14-10-12-4-3-9-16-11-12/h4,13-14H,2-3,5-11H2,1H3 |
| InChIKey | CCGXAJXBOJRRAO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine?
The IUPAC name of N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine (CID 115674406) is N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine.
What is the SMILES notation for N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine?
The canonical SMILES for N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine is CCN(CCNCC1=CCCOC1)C1CC1.
What is the InChIKey of N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine?
The InChIKey is CCGXAJXBOJRRAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c1-2-15(13-5-6-13)8-7-14-10-12-4-3-9-16-11-12/h4,13-14H,2-3,5-11H2,1H3.
What are the key properties of N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine?
N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine has a molecular weight of 224.35 g/mol, XLogP of 1.41, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N-(3,6-dihydro-2H-pyran-5-ylmethyl)-N'-ethylethane-1,2-diamine is sourced from PubChem (CID 115674406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).