C23H28O4S — CID 11567535
3-[4-(2-hydroxyethoxy)-2-methoxyphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 11567535) has the molecular formula C23H28O4S and a molecular weight of 400.54 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethoxy)-2-methoxyphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[4-(2-hydroxyethoxy)-2-methoxyphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 11567535 |
| Molecular Formula | C23H28O4S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-[4-(2-hydroxyethoxy)-2-methoxyphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | COc1cc(OCCO)ccc1CCC(=O)c1sc(C)c2c1C[C@@H]1[C@H]2C1(C)C |
| InChI | InChI=1S/C23H28O4S/c1-13-20-16(12-17-21(20)23(17,2)3)22(28-13)18(25)8-6-14-5-7-15(27-10-9-24)11-19(14)26-4/h5,7,11,17,21,24H,6,8-10,12H2,1-4H3/t17-,21-/m1/s1 |
| InChIKey | DKBBGBRLXWNOHV-DYESRHJHSA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |