About 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile
5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile (PubChem CID 115675922) has the molecular formula C14H20N2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile |
| PubChem CID | 115675922 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile |
| SMILES | CC1CC(C)CC(NCc2ccc(C#N)s2)C1 |
| InChI | InChI=1S/C14H20N2S/c1-10-5-11(2)7-12(6-10)16-9-14-4-3-13(8-15)17-14/h3-4,10-12,16H,5-7,9H2,1-2H3 |
| InChIKey | CURNYYHQMZCLGT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile?
The IUPAC name of 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile (CID 115675922) is 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile.
What is the SMILES notation for 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile?
The canonical SMILES for 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile is CC1CC(C)CC(NCc2ccc(C#N)s2)C1.
What is the InChIKey of 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile?
The InChIKey is CURNYYHQMZCLGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2S/c1-10-5-11(2)7-12(6-10)16-9-14-4-3-13(8-15)17-14/h3-4,10-12,16H,5-7,9H2,1-2H3.
What are the key properties of 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile?
5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile has a molecular weight of 248.39 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3,5-dimethylcyclohexyl)amino]methyl]thiophene-2-carbonitrile is sourced from PubChem (CID 115675922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).