About N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine (PubChem CID 115676151) has the molecular formula C13H16BrNO2S
and a molecular weight of 330.25 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine.
Molecular Properties
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine |
| PubChem CID | 115676151 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine |
| SMILES | Brc1cc2c(cc1CNC1CCCSC1)OCO2 |
| InChI | InChI=1S/C13H16BrNO2S/c14-11-5-13-12(16-8-17-13)4-9(11)6-15-10-2-1-3-18-7-10/h4-5,10,15H,1-3,6-8H2 |
| InChIKey | NRZUZEWVCUFUSW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine?
The IUPAC name of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine (CID 115676151) is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine.
What is the SMILES notation for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine?
The canonical SMILES for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine is Brc1cc2c(cc1CNC1CCCSC1)OCO2.
What is the InChIKey of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine?
The InChIKey is NRZUZEWVCUFUSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2S/c14-11-5-13-12(16-8-17-13)4-9(11)6-15-10-2-1-3-18-7-10/h4-5,10,15H,1-3,6-8H2.
What are the key properties of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine?
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine has a molecular weight of 330.25 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]thian-3-amine is sourced from PubChem (CID 115676151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).