C15H23NO2S2 — CID 115676162
N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]thian-3-amine (PubChem CID 115676162) has the molecular formula C15H23NO2S2 and a molecular weight of 313.49 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]thian-3-amine.
| Compound Name | N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]thian-3-amine |
|---|---|
| PubChem CID | 115676162 |
| Molecular Formula | C15H23NO2S2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]thian-3-amine |
| SMILES | COc1cc(CNC2CCCSC2)c(SC)cc1OC |
| InChI | InChI=1S/C15H23NO2S2/c1-17-13-7-11(15(19-3)8-14(13)18-2)9-16-12-5-4-6-20-10-12/h7-8,12,16H,4-6,9-10H2,1-3H3 |
| InChIKey | XTUIKGNQYMDHIQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |