C24H40N2O3 — CID 11567627
N-[(2S,3S)-3-hydroxy-1-morpholin-4-yl-4-phenylbutan-2-yl]decanamide (PubChem CID 11567627) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is N-[(2S,3S)-3-hydroxy-1-morpholin-4-yl-4-phenylbutan-2-yl]decanamide.
| Compound Name | N-[(2S,3S)-3-hydroxy-1-morpholin-4-yl-4-phenylbutan-2-yl]decanamide |
|---|---|
| PubChem CID | 11567627 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | N-[(2S,3S)-3-hydroxy-1-morpholin-4-yl-4-phenylbutan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@@H](CN1CCOCC1)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C24H40N2O3/c1-2-3-4-5-6-7-11-14-24(28)25-22(20-26-15-17-29-18-16-26)23(27)19-21-12-9-8-10-13-21/h8-10,12-13,22-23,27H,2-7,11,14-20H2,1H3,(H,25,28)/t22-,23-/m0/s1 |
| InChIKey | QLAKYDZXVRVJAP-GOTSBHOMSA-N |
| XLogP | 3.55 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|