C10H19N3O2 — CID 115676331
3-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]butanamide (PubChem CID 115676331) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]butanamide.
| Compound Name | 3-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]butanamide |
|---|---|
| PubChem CID | 115676331 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]butanamide |
| SMILES | CC(CC(N)=O)NCC(=O)N1CCCC1 |
| InChI | InChI=1S/C10H19N3O2/c1-8(6-9(11)14)12-7-10(15)13-4-2-3-5-13/h8,12H,2-7H2,1H3,(H2,11,14) |
| InChIKey | GHJKSBDNUBYAMJ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |