About N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide
N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide (PubChem CID 11567764) has the molecular formula C21H25N5O2S
and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide |
| PubChem CID | 11567764 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide |
| SMILES | C[C@@H]1CN(c2cccc(NS(=O)(=O)c3ccc(-n4cccn4)cc3)c2)C[C@H](C)N1 |
| InChI | InChI=1S/C21H25N5O2S/c1-16-14-25(15-17(2)23-16)20-6-3-5-18(13-20)24-29(27,28)21-9-7-19(8-10-21)26-12-4-11-22-26/h3-13,16-17,23-24H,14-15H2,1-2H3/t16-,17+ |
| InChIKey | MICFLIXXNPGJIP-CALCHBBNSA-N |
| XLogP | 2.86 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_H(6)', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide?
The IUPAC name of N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide (CID 11567764) is N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide.
What is the SMILES notation for N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide?
The canonical SMILES for N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide is C[C@@H]1CN(c2cccc(NS(=O)(=O)c3ccc(-n4cccn4)cc3)c2)C[C@H](C)N1.
What is the InChIKey of N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide?
The InChIKey is MICFLIXXNPGJIP-CALCHBBNSA-N. The full InChI is InChI=1S/C21H25N5O2S/c1-16-14-25(15-17(2)23-16)20-6-3-5-18(13-20)24-29(27,28)21-9-7-19(8-10-21)26-12-4-11-22-26/h3-13,16-17,23-24H,14-15H2,1-2H3/t16-,17+.
What are the key properties of N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide?
N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide has a molecular weight of 411.53 g/mol, XLogP of 2.86, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]phenyl]-4-pyrazol-1-ylbenzenesulfonamide is sourced from PubChem (CID 11567764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).