C23H24ClFN2O2 — CID 11567836
7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol (PubChem CID 11567836) has the molecular formula C23H24ClFN2O2 and a molecular weight of 414.91 g/mol. Its IUPAC name is 7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol.
| Compound Name | 7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
|---|---|
| PubChem CID | 11567836 |
| Molecular Formula | C23H24ClFN2O2 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)C(O)C3NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H24ClFN2O2/c1-13-10-20(24)27-18-11-17-19(12-16(13)18)29-23(2,3)22(28)21(17)26-9-8-14-4-6-15(25)7-5-14/h4-7,10-12,21-22,26,28H,8-9H2,1-3H3 |
| InChIKey | SJROYWSEXZWKAM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|