About propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate
propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate (PubChem CID 11567906) has the molecular formula C23H32FN3O3
and a molecular weight of 417.53 g/mol. Its IUPAC name is propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate |
| PubChem CID | 11567906 |
| Molecular Formula | C23H32FN3O3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate |
| SMILES | CCCOC(=O)N1CCC(N2CCC3(CC2)CN(C(C)=O)c2ccc(F)cc23)CC1 |
| InChI | InChI=1S/C23H32FN3O3/c1-3-14-30-22(29)26-10-6-19(7-11-26)25-12-8-23(9-13-25)16-27(17(2)28)21-5-4-18(24)15-20(21)23/h4-5,15,19H,3,6-14,16H2,1-2H3 |
| InChIKey | QFPXGJDLISLESM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate?
The IUPAC name of propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate (CID 11567906) is propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate.
What is the SMILES notation for propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate?
The canonical SMILES for propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate is CCCOC(=O)N1CCC(N2CCC3(CC2)CN(C(C)=O)c2ccc(F)cc23)CC1.
What is the InChIKey of propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate?
The InChIKey is QFPXGJDLISLESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32FN3O3/c1-3-14-30-22(29)26-10-6-19(7-11-26)25-12-8-23(9-13-25)16-27(17(2)28)21-5-4-18(24)15-20(21)23/h4-5,15,19H,3,6-14,16H2,1-2H3.
What are the key properties of propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate?
propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate has a molecular weight of 417.53 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate is sourced from PubChem (CID 11567906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).