C10H11N3O2 — CID 115679422
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-one (PubChem CID 115679422) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-one.
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 115679422 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrimidin-4-one |
| SMILES | Cc1noc(C)c1Cn1cnccc1=O |
| InChI | InChI=1S/C10H11N3O2/c1-7-9(8(2)15-12-7)5-13-6-11-4-3-10(13)14/h3-4,6H,5H2,1-2H3 |
| InChIKey | VAYRHMVTJNQECC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |