C22H29ClN2O2S — CID 11567978
7-chloro-2,2,9-trimethyl-4-[2-(thian-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol (PubChem CID 11567978) has the molecular formula C22H29ClN2O2S and a molecular weight of 421.01 g/mol. Its IUPAC name is 7-chloro-2,2,9-trimethyl-4-[2-(thian-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol.
| Compound Name | 7-chloro-2,2,9-trimethyl-4-[2-(thian-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
|---|---|
| PubChem CID | 11567978 |
| Molecular Formula | C22H29ClN2O2S |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 7-chloro-2,2,9-trimethyl-4-[2-(thian-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)C(O)C3NCCC1CCSCC1 |
| InChI | InChI=1S/C22H29ClN2O2S/c1-13-10-19(23)25-17-11-16-18(12-15(13)17)27-22(2,3)21(26)20(16)24-7-4-14-5-8-28-9-6-14/h10-12,14,20-21,24,26H,4-9H2,1-3H3 |
| InChIKey | HSXRMLRUJJJOPX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|