C16H13ClN4O6S — CID 11568051
10-chloro-N-(diaminomethylidene)-1-methyl-8-nitro-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 11568051) has the molecular formula C16H13ClN4O6S and a molecular weight of 424.82 g/mol. Its IUPAC name is 10-chloro-N-(diaminomethylidene)-1-methyl-8-nitro-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | 10-chloro-N-(diaminomethylidene)-1-methyl-8-nitro-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 11568051 |
| Molecular Formula | C16H13ClN4O6S |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 10-chloro-N-(diaminomethylidene)-1-methyl-8-nitro-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N=C(N)N)cc2c1Oc1c(Cl)cc([N+](=O)[O-])cc1CS2(=O)=O |
| InChI | InChI=1S/C16H13ClN4O6S/c1-7-2-8(15(22)20-16(18)19)4-12-13(7)27-14-9(6-28(12,25)26)3-10(21(23)24)5-11(14)17/h2-5H,6H2,1H3,(H4,18,19,20,22) |
| InChIKey | PJSGMRATFCPBGN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 167.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|