C23H21F3N2O3 — CID 11568167
2-[3-[methyl-[2-(trifluoromethyl)phenyl]carbamoyl]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 11568167) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 2-[3-[methyl-[2-(trifluoromethyl)phenyl]carbamoyl]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-[methyl-[2-(trifluoromethyl)phenyl]carbamoyl]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 11568167 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-[3-[methyl-[2-(trifluoromethyl)phenyl]carbamoyl]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | CN(C(=O)C1CCc2c(c3ccccc3n2CC(=O)O)C1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H21F3N2O3/c1-27(20-9-5-3-7-17(20)23(24,25)26)22(31)14-10-11-19-16(12-14)15-6-2-4-8-18(15)28(19)13-21(29)30/h2-9,14H,10-13H2,1H3,(H,29,30) |
| InChIKey | ABLDXWKOPNYWAQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|